CuO(s)-Cu(s)+1/2 O2(g) C02(g)→C(s)+02(g) Cu(s)+C(s)+3/2O2(g)-CuCO3(s) 6.Which of the following is true? A.Thermodynamically,the reaction is different from the reaction system B.The reaction will occur faster than the reaction system C.The reaction will have a much greater H than the overall H of the reaction system D.The AH of the reaction is the same as theH of the overall system E.None of these 7..The enthalpy of formation of Na(s)is: A.Negative B.Positive C.Zero D.Unknown 8..The subscript f in the term AHr means: A.Formation of the compound from the elements. B.Fluorine C.Fairly big D.Fairly small E.Something impolite Part2 1.An endothermic reaction: Will not proceed Releases heat to the surroundings Absorbs heat from the surroundings Releases free energy Has a negative value of H 2.An exothermic reaction: CAbsorbs heat Will always be fast Will always be slow Absorbs free energy Has a negative value of H 3.Compare the reaction CuO+COz)=CuCO3)with the reaction system:CuO(s) → Cu(s) + 1/2 O2(g) CO2(g) → C(s) + O2(g) Cu(s) + C(s) + 3/2 O2(g) → CuCO3(s) 6.Which of the following is true? A. Thermodynamically, the reaction is different from the reaction system B. The reaction will occur faster than the reaction system C. The reaction will have a much greater △H than the overall △H of the reaction system D. The △H of the reaction is the same as the△H of the overall system E. None of these 7.. The enthalpy of formation of Na(s) is: A. Negative B. Positive C. Zero D. Unknown 8.. The subscript f in the term △Ho f means: A. Formation of the compound from the elements. B. Fluorine C. Fairly big D. Fairly small E. Something impolite. Part 2 1. An endothermic reaction: Will not proceed Releases heat to the surroundings Absorbs heat from the surroundings Releases free energy Has a negative value of H 2. An exothermic reaction: Absorbs heat Will always be fast Will always be slow Absorbs free energy Has a negative value of H 3. Compare the reaction CuO(s) + CO2(g) = CuCO3(s) with the reaction system: