3. Propose a route to synthesize the hydrolyzable polymer shown below. Show the structure of the monomers you would use and any initiators/catalysts CH3 CH3-c-0-F-CH2-CH2-O-(C-CH-O-C-CH-N)M-H CH3 O NH 4. In order to carry out studies of polymer hydrolysis on reasonable experimental timescales, a number of researchers have used elevated temperature to speed up degradation. Using the data given below, determine the degradation mechanism (surface or bulk erosion) for a sample of polycaprolactone (p=1. 146 g/cm)0.02m thick degraded in water at 37C and whether the mechanism is changed by degrading the sample at 85.(Hint: assume both the hydrolysis rate constant and the diffusivity of water in the polymer have an Arrhenius form At37°C:k=9.7×103s1 0°cms At50°C:k=5.4×107s1 5×103cm k= rate constant of PCL bond hydrolysis DH20=diffusivity of water in PCL E4623962JPS1 20f23. Propose a route to synthesize the hydrolyzable polymer shown below. Show the structure of the monomers you would use and any initiators/catalysts. CH3 O O H CH3-C-O-C-CH2-CH2-O-(C-CH-O-C-CH-N)n-H CH3 O CH3 (CH2)4 NH2 4. In order to carry out studies of polymer hydrolysis on reasonable experimental timescales, a number of researchers have used elevated temperature to speed up degradation. Using the data given below, determine the degradation mechanism (surface or bulk erosion) for a sample of polycaprolactone (ρ = 1.146 g/cm3 ) 0.02m thick degraded in water at 37°C and whether the mechanism is changed by degrading the sample at 85°. (Hint: assume both the hydrolysis rate constant and the diffusivity of water in the polymer have an Arrhenius form.) At 37°C: k = 9.7x10-8 s-1 DH2O = 10-8 cm2 s-1 At 50°C: k = 5.4x10-7 s-1 DH2O = 3.5x10-8 cm2 s-1 k = rate constant of PCL bond hydrolysis DH2O = diffusivity of water in PCL BE.462J/3.962J PS 1 2 of 2