Kis the equilibrium constant for the reaction at temperature T Part B.Answer each question.Best two answers will count.(20 marks each) B1.Balance the following reaction in a basic solution:S2O+ClO2(SO+Clg) S,062e→2S042am S2062em+2H200→2S042a S2O6+2 H2O)>2 SO4)+4 H(o) S2062m+2H200→2S042ag+4fam+2e Then the reduction reaction: 2CI0:eo→Cl2g 2C102am→C12g+4H20 2ClO2 (ag)+8 H'(ag)>Cl2(g)+4 H2O0) 2ClOz(+8 H'ag)+6eCl2(g)+4 H2O) Multiply the oxidation reaction by 3 to make the electrons cancel and add the two half reactions: 3S2062a+6H20→6S042m+12Hfam+6c 2 ClO2 (ag)+8 H'(ag)+6 e>Cl2(g)+4 H2O) 3S2062eg+2H0u+2C10ze侧→6S042am+4Hm+C12g To convert to basic solution,add 4OH to both sides 3 S206(ag)+2 H2O+2 CIO2(g)+4 OH(og)6 SO4(ag)+4 H(ag)+4OH(ag)+Cl2(g) and cancel the resultant waters: Keq is the equilibrium constant for the reaction at temperature T Part B. Answer each question. Best two answers will count. (20 marks each) B1. Balance the following reaction in a basic solution: S2O6 -2 (aq) + ClO2 − (aq) → SO4 −2 (aq) + Cl2(g) S2O6 -2 (aq) → 2 SO4 -2 (aq) S2O6 -2 (aq) + 2 H2O(l) → 2 SO4 -2 (aq) S2O6 -2 (aq) + 2 H2O(l) → 2 SO4 -2 (aq) + 4 H+ (aq) S2O6 -2 (aq) + 2 H2O(l) → 2 SO4 -2 (aq) + 4 H+ (aq) + 2 e￾Then the reduction reaction: 2ClO2 - (aq) → Cl2(g) 2ClO2 - (aq) → Cl2(g) + 4 H2O(l) 2ClO2 - (aq) + 8 H+ (aq) → Cl2(g) + 4 H2O(l) 2ClO2 - (aq) + 8 H+ (aq) + 6 e- → Cl2(g) + 4 H2O(l) Multiply the oxidation reaction by 3 to make the electrons cancel and add the two half reactions: 3 S2O6 -2 (aq) + 6 H2O(l) → 6 SO4 -2 (aq) + 12 H+ (aq) + 6 e- 2 ClO2 - (aq) + 8 H+ (aq) + 6 e- → Cl2(g) + 4 H2O(l) ___________________________________________ 3 S2O6 -2 (aq) + 2 H2O(l) + 2ClO2 - (aq) → 6 SO4 -2 (aq) + 4 H+ (aq) + Cl2(g) To convert to basic solution, add 4 OH- (aq) to both sides: 3 S2O6 -2 (aq) + 2 H2O(l) + 2 ClO2 - (aq) + 4 OH- (aq) → 6 SO4 -2 (aq) + 4 H+ (aq) + 4 OH- (aq)+ Cl2(g) and cancel the resultant waters: